Products 190071-25-1
CAS 190071-25-1 appears in our catalog under these names: Methyl 2-phenyl-1H-indole-5-carboxylate 95%, 1H-Indole-5-carboxylic acid, 2-phenyl-, methyl ester, >95%, >95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Methyl 2-phenyl-1H-indole-5-carboxylate (CAS 190071-25-1) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: methyl 2-phenyl-1H-indole-5-carboxylate. InChIKey: QRCCAIGGRLMANJ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | methyl 2-phenyl-1H-indole-5-carboxylate |
| InChIKey | QRCCAIGGRLMANJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)