CAS 19013-15-1 appears in our catalog under these names: Ethyl 4-methyl-3-nitrobenzoate 95+%, Ethyl 4-methyl-3-nitrobenzoate, 95+%, 95+%, Ethyl 4-methyl-3-nitrobenzoate, 95+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 500g.
Ethyl 4-methyl-3-nitrobenzoate (CAS 19013-15-1) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: ethyl 4-methyl-3-nitrobenzoate. InChIKey: FWOACYVHDUBZDT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | ethyl 4-methyl-3-nitrobenzoate |
| InChIKey | FWOACYVHDUBZDT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)