Products 1903009-70-0
CAS 1903009-70-0 is the registry number for N-(2-Methoxy-4-morpholino-5-nitrophenyl)formamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
N-(2-methoxy-4-morpholin-4-yl-5-nitrophenyl)formamide (CAS 1903009-70-0) is a chemical compound with the molecular formula C12H15N3O5 and a molecular weight of 281.26 g/mol. IUPAC name: N-(2-methoxy-4-morpholin-4-yl-5-nitrophenyl)formamide. InChIKey: CFUNLIKOHNWOSD-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O5 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | N-(2-methoxy-4-morpholin-4-yl-5-nitrophenyl)formamide |
| InChIKey | CFUNLIKOHNWOSD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1NC=O)[N+](=O)[O-])N2CCOCC2 |
Computed by PubChem (NCBI)