Products 872201-68-8
CAS 872201-68-8 is the registry number for Antiviral agent 44. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3R,4R,5R)-2-(4-aminofuro[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 872201-68-8) is a chemical compound with the molecular formula C12H15N3O5 and a molecular weight of 281.26 g/mol. IUPAC name: (2S,3R,4R,5R)-2-(4-aminofuro[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: XTZBWEWBGPBBQG-NUBDZMHLSA-N.
| Molecular formula | C12H15N3O5 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S,3R,4R,5R)-2-(4-aminofuro[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | XTZBWEWBGPBBQG-NUBDZMHLSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1C2=COC3=C2N=CN=C3N)CO)O)O |
Computed by PubChem (NCBI)