CAS 1903427-21-3 is the registry number for Rel-tert-butyl ((1R,2S)-2-cyanocyclopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,2S)-2-cyanocyclopropyl]carbamate (CAS 1903427-21-3) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-2-cyanocyclopropyl]carbamate. InChIKey: QFUOUEURKHWBNS-RNFRBKRXSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S)-2-cyanocyclopropyl]carbamate |
| InChIKey | QFUOUEURKHWBNS-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]1C#N |
Computed by PubChem (NCBI)