Products 2165958-96-1
CAS 2165958-96-1 is the registry number for tert-Butyl ((1S,2R)-2-cyanocyclopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S,2R)-2-cyanocyclopropyl]carbamate (CAS 2165958-96-1) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-cyanocyclopropyl]carbamate. InChIKey: QFUOUEURKHWBNS-BQBZGAKWSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-cyanocyclopropyl]carbamate |
| InChIKey | QFUOUEURKHWBNS-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]1C#N |
Computed by PubChem (NCBI)