Products 190379-82-9

CAS 190379-82-9 is the registry number for 3-Carboxy Mefenamic Acid. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

3-(2-carboxyanilino)-2-methylbenzoic acid (CAS 190379-82-9) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 3-(2-carboxyanilino)-2-methylbenzoic acid. InChIKey: OOQQWHSTKBWQPB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO4
Molecular weight271.27 g/mol
IUPAC name3-(2-carboxyanilino)-2-methylbenzoic acid
InChIKeyOOQQWHSTKBWQPB-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1NC2=CC=CC=C2C(=O)O)C(=O)O

Computed by PubChem (NCBI)