Products 19039-94-2
CAS 19039-94-2 is the registry number for 4-(3,4,5-Trimethoxyphenyl)but-3-en-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one (CAS 19039-94-2) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one. InChIKey: DPZIOGVAJXVGGL-AATRIKPKSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one |
| InChIKey | DPZIOGVAJXVGGL-AATRIKPKSA-N |
| SMILES | CC(=O)/C=C/C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)