Products 190586-91-5

CAS 190586-91-5 is the registry number for Benzyl 5-{((tert-butoxy)carbonyl)amino}pentanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Benzyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 190586-91-5) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: benzyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: OPIRUKYFTHVMTN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25NO4
Molecular weight307.4 g/mol
IUPAC namebenzyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate
InChIKeyOPIRUKYFTHVMTN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCCC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)