CAS 190728-24-6 appears in our catalog under these names: Cabozantinib Impurity 13, 6,7-Dimethoxy-4-(4-nitrophenoxy)quinoline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
6,7-dimethoxy-4-(4-nitrophenoxy)quinoline (CAS 190728-24-6) is a chemical compound with the molecular formula C17H14N2O5 and a molecular weight of 326.30 g/mol. IUPAC name: 6,7-dimethoxy-4-(4-nitrophenoxy)quinoline. InChIKey: YRYKZXCOGVCXBN-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O5 |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | 6,7-dimethoxy-4-(4-nitrophenoxy)quinoline |
| InChIKey | YRYKZXCOGVCXBN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)