CAS 394228-95-6 is the registry number for 3-(2-Hydroxy-4-methoxyphenyl)-4-(4-carboxyphenoxy)-1H-pyrazole. Offered by: TRC. Available pack sizes: 100mg.
4-[[5-(2-hydroxy-4-methoxyphenyl)-1H-pyrazol-4-yl]oxy]benzoic acid (CAS 394228-95-6) is a chemical compound with the molecular formula C17H14N2O5 and a molecular weight of 326.30 g/mol. IUPAC name: 4-[[5-(2-hydroxy-4-methoxyphenyl)-1H-pyrazol-4-yl]oxy]benzoic acid. InChIKey: GGYBKIBKGILMSS-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O5 |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | 4-[[5-(2-hydroxy-4-methoxyphenyl)-1H-pyrazol-4-yl]oxy]benzoic acid |
| InChIKey | GGYBKIBKGILMSS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=C(C=NN2)OC3=CC=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)