CAS 190728-26-8 is the registry number for Cabozantinib Impurity 49. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6,7-dimethoxy-4-(2-nitrophenoxy)quinoline (CAS 190728-26-8) is a chemical compound with the molecular formula C17H14N2O5 and a molecular weight of 326.30 g/mol. IUPAC name: 6,7-dimethoxy-4-(2-nitrophenoxy)quinoline. InChIKey: HBSQQKYKHLJADA-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O5 |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | 6,7-dimethoxy-4-(2-nitrophenoxy)quinoline |
| InChIKey | HBSQQKYKHLJADA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)