Products 1809024-62-1
CAS 1809024-62-1 is the registry number for Methyl 3-(2-amino-3-(benzyloxy)-5-nitrophenyl)propiolate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2-amino-5-nitro-3-phenylmethoxyphenyl)prop-2-ynoate (CAS 1809024-62-1) is a chemical compound with the molecular formula C17H14N2O5 and a molecular weight of 326.30 g/mol. IUPAC name: methyl 3-(2-amino-5-nitro-3-phenylmethoxyphenyl)prop-2-ynoate. InChIKey: ZBBXLAORWSJJJE-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O5 |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | methyl 3-(2-amino-5-nitro-3-phenylmethoxyphenyl)prop-2-ynoate |
| InChIKey | ZBBXLAORWSJJJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C#CC1=C(C(=CC(=C1)[N+](=O)[O-])OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)