Products 1353636-05-1
CAS 1353636-05-1 is the registry number for 6-(Benzyloxy)-7-methoxy-3-nitroquinolin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-3-nitro-6-phenylmethoxy-1H-quinolin-4-one (CAS 1353636-05-1) is a chemical compound with the molecular formula C17H14N2O5 and a molecular weight of 326.30 g/mol. IUPAC name: 7-methoxy-3-nitro-6-phenylmethoxy-1H-quinolin-4-one. InChIKey: ZSPAOJXMZLOXPE-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O5 |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | 7-methoxy-3-nitro-6-phenylmethoxy-1H-quinolin-4-one |
| InChIKey | ZSPAOJXMZLOXPE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC=C(C2=O)[N+](=O)[O-])OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)