CAS 190911-79-6 appears in our catalog under these names: 3',5'-Dichlorobiphenyl-4-carboxylic acid, 95%, 3',5'-Dichloro-[1,1'-biphenyl]-4-carboxylic acid 95%, 3',5'-Dichloro-biphenyl-4-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-(3,5-dichlorophenyl)benzoic acid (CAS 190911-79-6) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 4-(3,5-dichlorophenyl)benzoic acid. InChIKey: IFTKERBYCONAST-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 4-(3,5-dichlorophenyl)benzoic acid |
| InChIKey | IFTKERBYCONAST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)