CAS 380228-57-9 appears in our catalog under these names: 3-(3,5-Dichlorophenyl)benzoic acid, 95%, 3',5'-Dichloro-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
3-(3,5-dichlorophenyl)benzoic acid (CAS 380228-57-9) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)benzoic acid. InChIKey: DJCRAGQDESWSPY-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)benzoic acid |
| InChIKey | DJCRAGQDESWSPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)