Products 380228-58-0
CAS 380228-58-0 is the registry number for 2',4'-Dichlorobiphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-(2,4-dichlorophenyl)benzoic acid (CAS 380228-58-0) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)benzoic acid. InChIKey: WUBAPTMRZKVPLO-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)benzoic acid |
| InChIKey | WUBAPTMRZKVPLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)