CAS 916849-01-9 is the registry number for 2-(3,4-Dichlorophenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(3,4-dichlorophenyl)benzoic acid (CAS 916849-01-9) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)benzoic acid. InChIKey: FVPONOIRLZMLAB-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)benzoic acid |
| InChIKey | FVPONOIRLZMLAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)