CAS 7111-63-9 is the registry number for 4-(2,3-Dichlorophenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(2,3-dichlorophenyl)benzoic acid (CAS 7111-63-9) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)benzoic acid. InChIKey: STLGUJTWUAPIIL-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)benzoic acid |
| InChIKey | STLGUJTWUAPIIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)