Products 7111-63-9

CAS 7111-63-9 is the registry number for 4-(2,3-Dichlorophenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(2,3-dichlorophenyl)benzoic acid (CAS 7111-63-9) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)benzoic acid. InChIKey: STLGUJTWUAPIIL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl2O2
Molecular weight267.10 g/mol
IUPAC name4-(2,3-dichlorophenyl)benzoic acid
InChIKeySTLGUJTWUAPIIL-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)