CAS 1909309-55-2 appears in our catalog under these names: 2-(2-Methyl-1,3-dioxolan-2-yl)-1,3-thiazole-5-carboxylic acid, 2-(2-Methyl-1,3-dioxolan-2-yl)thiazole-5-carboxylic acid, 95%, 2-(2-Methyl-1,3-dioxolan-2-yl)thiazole-5-carboxylic acid, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 10mg, 25mg, 100mg, 250mg, 1g.
2-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazole-5-carboxylic acid (CAS 1909309-55-2) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 2-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: JCQYKYMSPOLQOP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 2-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | JCQYKYMSPOLQOP-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)