Products 1909326-16-4
CAS 1909326-16-4 is the registry number for N-((2,3-Dihydro-1H-indol-2-yl)methyl)-2,2,2-trifluoroacetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(2,3-dihydro-1H-indol-2-ylmethyl)-2,2,2-trifluoroacetamide (CAS 1909326-16-4) is a chemical compound with the molecular formula C11H11F3N2O and a molecular weight of 244.21 g/mol. IUPAC name: N-(2,3-dihydro-1H-indol-2-ylmethyl)-2,2,2-trifluoroacetamide. InChIKey: PCEXPODRFRXERJ-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-indol-2-ylmethyl)-2,2,2-trifluoroacetamide |
| InChIKey | PCEXPODRFRXERJ-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C21)CNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)