CAS 1909326-35-7 is the registry number for tert-Butyl 3-carbamothioylbenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 3-carbamothioylbenzoate (CAS 1909326-35-7) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: tert-butyl 3-carbamothioylbenzoate. InChIKey: ICDHIWNFHHLVRR-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | tert-butyl 3-carbamothioylbenzoate |
| InChIKey | ICDHIWNFHHLVRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C(=S)N |
Computed by PubChem (NCBI)