Products 1909327-13-4
CAS 1909327-13-4 is the registry number for 2-(1,4-Diazepan-1-yl)pyridine-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1,4-diazepan-1-yl)pyridine-4-carboxylic acid;hydrochloride (CAS 1909327-13-4) is a chemical compound with the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. IUPAC name: 2-(1,4-diazepan-1-yl)pyridine-4-carboxylic acid;hydrochloride. InChIKey: OWBLCHOBEMFESM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O2 |
|---|---|
| Molecular weight | 257.72 g/mol |
| IUPAC name | 2-(1,4-diazepan-1-yl)pyridine-4-carboxylic acid;hydrochloride |
| InChIKey | OWBLCHOBEMFESM-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)