Products 1909347-62-1
CAS 1909347-62-1 is the registry number for 3-(Dimethylsulfamoyl)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(dimethylsulfamoyl)pyridine-2-carboxylic acid (CAS 1909347-62-1) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: 3-(dimethylsulfamoyl)pyridine-2-carboxylic acid. InChIKey: ZJONZCOYEHXDAF-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 3-(dimethylsulfamoyl)pyridine-2-carboxylic acid |
| InChIKey | ZJONZCOYEHXDAF-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(N=CC=C1)C(=O)O |
Computed by PubChem (NCBI)