Products 1909347-93-8
CAS 1909347-93-8 is the registry number for 5-tert-Butylbenzene-1,3-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-tert-butylbenzene-1,3-diamine;dihydrochloride (CAS 1909347-93-8) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 5-tert-butylbenzene-1,3-diamine;dihydrochloride. InChIKey: ONJHKLZPYOJODC-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 5-tert-butylbenzene-1,3-diamine;dihydrochloride |
| InChIKey | ONJHKLZPYOJODC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)