Products 1909348-33-9

CAS 1909348-33-9 is the registry number for 4-((Pyridin-4-yl)methoxy)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-(pyridin-4-ylmethoxy)benzoic acid;hydrochloride (CAS 1909348-33-9) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: 4-(pyridin-4-ylmethoxy)benzoic acid;hydrochloride. InChIKey: GMRZXLCPOLAHKI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO3
Molecular weight265.69 g/mol
IUPAC name4-(pyridin-4-ylmethoxy)benzoic acid;hydrochloride
InChIKeyGMRZXLCPOLAHKI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OCC2=CC=NC=C2.Cl

Computed by PubChem (NCBI)