CAS 1909348-33-9 is the registry number for 4-((Pyridin-4-yl)methoxy)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(pyridin-4-ylmethoxy)benzoic acid;hydrochloride (CAS 1909348-33-9) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: 4-(pyridin-4-ylmethoxy)benzoic acid;hydrochloride. InChIKey: GMRZXLCPOLAHKI-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 4-(pyridin-4-ylmethoxy)benzoic acid;hydrochloride |
| InChIKey | GMRZXLCPOLAHKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCC2=CC=NC=C2.Cl |
Computed by PubChem (NCBI)