Products 1909358-85-5
CAS 1909358-85-5 appears in our catalog under these names: 3-Methyl-4-(morpholin-4-yl)but-2-enoic acid hydrochloride, 95%, 3-Methyl-4-(morpholin-4-yl)but-2-enoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(E)-3-methyl-4-morpholin-4-ylbut-2-enoic acid;hydrochloride (CAS 1909358-85-5) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: (E)-3-methyl-4-morpholin-4-ylbut-2-enoic acid;hydrochloride. InChIKey: ODYOSPWAOMLAPY-WVLIHFOGSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (E)-3-methyl-4-morpholin-4-ylbut-2-enoic acid;hydrochloride |
| InChIKey | ODYOSPWAOMLAPY-WVLIHFOGSA-N |
| SMILES | C/C(=C\C(=O)O)/CN1CCOCC1.Cl |
Computed by PubChem (NCBI)