Products 191021-89-3
CAS 191021-89-3 appears in our catalog under these names: Alpha-(Phenylmethylene)-1-naphthaleneacetic Acid Ethyl Ester, a-(Phenylmethylene)-1-naphthaleneacetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Ethyl (Z)-2-naphthalen-1-yl-3-phenylprop-2-enoate (CAS 191021-89-3) is a chemical compound with the molecular formula C21H18O2 and a molecular weight of 302.4 g/mol. IUPAC name: ethyl (Z)-2-naphthalen-1-yl-3-phenylprop-2-enoate. InChIKey: IONVWFVQIRQILL-HKWRFOASSA-N.
| Molecular formula | C21H18O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | ethyl (Z)-2-naphthalen-1-yl-3-phenylprop-2-enoate |
| InChIKey | IONVWFVQIRQILL-HKWRFOASSA-N |
| SMILES | CCOC(=O)/C(=C\C1=CC=CC=C1)/C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)