CAS 756484-20-5 is the registry number for 4-Acetyl-3'-(benzyloxy)biphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[4-(3-phenylmethoxyphenyl)phenyl]ethanone (CAS 756484-20-5) is a chemical compound with the molecular formula C21H18O2 and a molecular weight of 302.4 g/mol. IUPAC name: 1-[4-(3-phenylmethoxyphenyl)phenyl]ethanone. InChIKey: BYFBNVVTFNNRAL-UHFFFAOYSA-N.
| Molecular formula | C21H18O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 1-[4-(3-phenylmethoxyphenyl)phenyl]ethanone |
| InChIKey | BYFBNVVTFNNRAL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)