Products 5543-97-5

CAS 5543-97-5 is the registry number for Clomifene Impurity 17. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-(4-methoxyphenyl)-1,2-diphenylethanone (CAS 5543-97-5) is a chemical compound with the molecular formula C21H18O2 and a molecular weight of 302.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,2-diphenylethanone. InChIKey: OSTWOIBSEBPRSM-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18O2
Molecular weight302.4 g/mol
IUPAC name2-(4-methoxyphenyl)-1,2-diphenylethanone
InChIKeyOSTWOIBSEBPRSM-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)