CAS 5543-97-5 is the registry number for Clomifene Impurity 17. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(4-methoxyphenyl)-1,2-diphenylethanone (CAS 5543-97-5) is a chemical compound with the molecular formula C21H18O2 and a molecular weight of 302.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,2-diphenylethanone. InChIKey: OSTWOIBSEBPRSM-UHFFFAOYSA-N.
| Molecular formula | C21H18O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1,2-diphenylethanone |
| InChIKey | OSTWOIBSEBPRSM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)