Products 971-85-7
CAS 971-85-7 appears in our catalog under these names: Triphenylmethyl Acetate, triphenylmethyl acetate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 25mg.
Trityl acetate (CAS 971-85-7) is a chemical compound with the molecular formula C21H18O2 and a molecular weight of 302.4 g/mol. IUPAC name: trityl acetate. InChIKey: HGRXPRZPNXRZKG-UHFFFAOYSA-N.
| Molecular formula | C21H18O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | trityl acetate |
| InChIKey | HGRXPRZPNXRZKG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)