CAS 4376-83-4 is the registry number for 3-(2-Hydroxyphenyl)-1,3-diphenylpropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3-(2-hydroxyphenyl)-1,3-diphenylpropan-1-one (CAS 4376-83-4) is a chemical compound with the molecular formula C21H18O2 and a molecular weight of 302.4 g/mol. IUPAC name: 3-(2-hydroxyphenyl)-1,3-diphenylpropan-1-one. InChIKey: FBSAPBMBVZHFQT-UHFFFAOYSA-N.
| Molecular formula | C21H18O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 3-(2-hydroxyphenyl)-1,3-diphenylpropan-1-one |
| InChIKey | FBSAPBMBVZHFQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)C2=CC=CC=C2)C3=CC=CC=C3O |
Computed by PubChem (NCBI)