CAS 1914135-89-9 is the registry number for 1-Bromoimidazo[1,2-a]quinoxalin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromoimidazo[1,2-a]quinoxalin-4-amine (CAS 1914135-89-9) is a chemical compound with the molecular formula C10H7BrN4 and a molecular weight of 263.09 g/mol. IUPAC name: 1-bromoimidazo[1,2-a]quinoxalin-4-amine. InChIKey: TWIYYYJLUPKKAZ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN4 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 1-bromoimidazo[1,2-a]quinoxalin-4-amine |
| InChIKey | TWIYYYJLUPKKAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C3=NC=C(N23)Br)N |
Computed by PubChem (NCBI)