Products 71856-56-9
CAS 71856-56-9 is the registry number for 5-amino-1-(3-bromophenyl)-1H-pyrazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-1-(3-bromophenyl)pyrazole-4-carbonitrile (CAS 71856-56-9) is a chemical compound with the molecular formula C10H7BrN4 and a molecular weight of 263.09 g/mol. IUPAC name: 5-amino-1-(3-bromophenyl)pyrazole-4-carbonitrile. InChIKey: GTANIIIAZUVWIW-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN4 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 5-amino-1-(3-bromophenyl)pyrazole-4-carbonitrile |
| InChIKey | GTANIIIAZUVWIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C(=C(C=N2)C#N)N |
Computed by PubChem (NCBI)