CAS 5334-28-1 appears in our catalog under these names: 5–Amino–1–(4–bromophenyl)–1H–pyrazole–4–carbonitrile, 5-Amino-1-(4-bromophenyl)-1H-pyrazole-4-carbonitrile, 97%, 97%, 5-Amino-1-(4-bromophenyl)-1H-pyrazole-4-carbonitrile, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g.
5-amino-1-(4-bromophenyl)pyrazole-4-carbonitrile (CAS 5334-28-1) is a chemical compound with the molecular formula C10H7BrN4 and a molecular weight of 263.09 g/mol. IUPAC name: 5-amino-1-(4-bromophenyl)pyrazole-4-carbonitrile. InChIKey: VWTGKVYPKFTDSL-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN4 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 5-amino-1-(4-bromophenyl)pyrazole-4-carbonitrile |
| InChIKey | VWTGKVYPKFTDSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C#N)N)Br |
Computed by PubChem (NCBI)