Products 2090867-75-5
CAS 2090867-75-5 is the registry number for 5-(4-bromophenyl)-3-methyl-triazole-4-carbonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-(4-bromophenyl)-3-methyltriazole-4-carbonitrile (CAS 2090867-75-5) is a chemical compound with the molecular formula C10H7BrN4 and a molecular weight of 263.09 g/mol. IUPAC name: 5-(4-bromophenyl)-3-methyltriazole-4-carbonitrile. InChIKey: QHWYYGUSSXLSIS-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN4 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3-methyltriazole-4-carbonitrile |
| InChIKey | QHWYYGUSSXLSIS-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=N1)C2=CC=C(C=C2)Br)C#N |
Computed by PubChem (NCBI)