Products 71856-54-7
CAS 71856-54-7 appears in our catalog under these names: 5–Amino–1–(2–bromophenyl)–1H–pyrazole–4–carbonitrile, 5-Amino-1-(2-bromophenyl)-1H-pyrazole-4-carbonitrile, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 500mg, 10g.
5-amino-1-(2-bromophenyl)pyrazole-4-carbonitrile (CAS 71856-54-7) is a chemical compound with the molecular formula C10H7BrN4 and a molecular weight of 263.09 g/mol. IUPAC name: 5-amino-1-(2-bromophenyl)pyrazole-4-carbonitrile. InChIKey: ZSXCRGHOGAZHHS-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN4 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 5-amino-1-(2-bromophenyl)pyrazole-4-carbonitrile |
| InChIKey | ZSXCRGHOGAZHHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=C(C=N2)C#N)N)Br |
Computed by PubChem (NCBI)