CAS 19161-44-5 is the registry number for 2,3,5,6-Tetrafluoro-4-methoxybenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2,3,5,6-tetrafluoro-4-methoxybenzaldehyde (CAS 19161-44-5) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-methoxybenzaldehyde. InChIKey: PCZBUBRBHGQWCL-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-methoxybenzaldehyde |
| InChIKey | PCZBUBRBHGQWCL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)C=O)F)F |
Computed by PubChem (NCBI)