Products 191668-31-2
CAS 191668-31-2 appears in our catalog under these names: 4-(4-Fluorophenyl)-1H-pyrrole-3-carboxylic acid, 4-(4-Fluorophenyl)-1h-pyrrole-3-carboxylic acid, 98%, 98%, 4-(4-Fluorophenyl)-1h-pyrrole-3-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g, 2.5g.
4-(4-fluorophenyl)-1H-pyrrole-3-carboxylic acid (CAS 191668-31-2) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 4-(4-fluorophenyl)-1H-pyrrole-3-carboxylic acid. InChIKey: ZIVPFZMWENLWSN-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-1H-pyrrole-3-carboxylic acid |
| InChIKey | ZIVPFZMWENLWSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC=C2C(=O)O)F |
Computed by PubChem (NCBI)