Products 19199-82-7
CAS 19199-82-7 appears in our catalog under these names: 4-Nitrophenyl 2-bromoacetate 95%, 4-Nitrophenyl 2-bromoacetate, 98%, 98%, 4-Nitrophenyl 2-bromoacetate, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
(4-nitrophenyl) 2-bromoacetate (CAS 19199-82-7) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: (4-nitrophenyl) 2-bromoacetate. InChIKey: HVNXGOPARVAZNX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | (4-nitrophenyl) 2-bromoacetate |
| InChIKey | HVNXGOPARVAZNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)CBr |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophenyl bromoacetate, p-Nitrophenyl bromoacetate, (4-nitrophenyl) 2-bromoacetate, Bromoacetic acid p-nitrophenyl ester, nitrophenylbromoacetate, p-nitrophenylbro-moacetate, p-Nitrophenylbromoacetic acid, 4-Nitrophenyl bromoacetate,98%, Bromoacetic acid 4-nitro-phenyl ester, Bromoacetic acid, 4-nitrophenyl ester