Products 1921239-77-1
CAS 1921239-77-1 is the registry number for 2-{((2R,6S)-2,6-Dimethylmorpholine-4-carbonyl)amino}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]amino]benzoic acid (CAS 1921239-77-1) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-[[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]amino]benzoic acid. InChIKey: CVUIQLJNLKJSDU-AOOOYVTPSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-[[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]amino]benzoic acid |
| InChIKey | CVUIQLJNLKJSDU-AOOOYVTPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C(=O)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)