CAS 193010-16-1 is the registry number for 1-(2,4-Dichlorobenzyl)-2-methyl-1H-benzo[d]imidazole-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxylic acid (CAS 193010-16-1) is a chemical compound with the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.2 g/mol. IUPAC name: 3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxylic acid. InChIKey: WZVJKXJRWSRGNA-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2O2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxylic acid |
| InChIKey | WZVJKXJRWSRGNA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1CC3=C(C=C(C=C3)Cl)Cl)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)