CAS 52803-56-2 is the registry number for Glafenic Acid Hydrchloride Salt. Offered by: TRC. Available pack sizes: 100mg.
2-[(7-chloroquinolin-4-yl)amino]benzoic acid;hydrochloride (CAS 52803-56-2) is a chemical compound with the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.2 g/mol. IUPAC name: 2-[(7-chloroquinolin-4-yl)amino]benzoic acid;hydrochloride. InChIKey: BZAQNWKWAIWREZ-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2O2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 2-[(7-chloroquinolin-4-yl)amino]benzoic acid;hydrochloride |
| InChIKey | BZAQNWKWAIWREZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=C3C=CC(=CC3=NC=C2)Cl.Cl |
Computed by PubChem (NCBI)