Products 84344-02-5
CAS 84344-02-5 appears in our catalog under these names: Lormetazepam-D3, Lormetazepam-D3, 0.1mg/ml in Acetonitrile, Lormetazepam-D3, 1mg/ml in Acetonitrile. Offered by: Lipomed. Available pack sizes: 50mg, 100mg, 10mg, 1ml.
7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 84344-02-5) is a chemical compound with the molecular formula C16H12Cl2N2O2 and a molecular weight of 338.2 g/mol. IUPAC name: 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: FJIKWRGCXUCUIG-FIBGUPNXSA-N.
| Molecular formula | C16H12Cl2N2O2 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | FJIKWRGCXUCUIG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)