CAS 54843-89-9 is the registry number for Lormetazepam Dione. Offered by: TRC. Available pack sizes: 50mg.
7-chloro-5-(2-chlorophenyl)-1-methyl-4,5-dihydro-1,4-benzodiazepine-2,3-dione (CAS 54843-89-9) is a chemical compound with the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.2 g/mol. IUPAC name: 7-chloro-5-(2-chlorophenyl)-1-methyl-4,5-dihydro-1,4-benzodiazepine-2,3-dione. InChIKey: HNEMPHKZCSCBCB-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2O2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 7-chloro-5-(2-chlorophenyl)-1-methyl-4,5-dihydro-1,4-benzodiazepine-2,3-dione |
| InChIKey | HNEMPHKZCSCBCB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(NC(=O)C1=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)