Products 743440-35-9
CAS 743440-35-9 is the registry number for 2-Cyano-3-(1-(2,5-dichlorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(E)-2-cyano-3-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoic acid (CAS 743440-35-9) is a chemical compound with the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.2 g/mol. IUPAC name: (E)-2-cyano-3-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoic acid. InChIKey: VTQYNBLCPPXOCY-WUXMJOGZSA-N.
| Molecular formula | C16H12Cl2N2O2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | (E)-2-cyano-3-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoic acid |
| InChIKey | VTQYNBLCPPXOCY-WUXMJOGZSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C=CC(=C2)Cl)Cl)C)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)