CAS 1931965-01-3 appears in our catalog under these names: (S)-3-((tert-Butoxycarbonyl)amino)hexanoic acid, (S)-3-((tert-butoxycarbonyl)amino)hexanoic acid, 97%, (S)-3-((tert-butoxycarbonyl)amino)hexanoic acid, 95%, (3S)-3-{[(tert-butoxy)carbonyl]amino}hexanoic acid, 95%, (S)-3-((tert-butoxycarbonyl)amino)hexanoic acid, 97%, 97%. Offered by: Biosynth, Fluorochem, Ambeed, Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 250mg, 500mg, 2.5g, 5g, 100mg.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1931965-01-3) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: WTYLEXCGLNFFIN-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | WTYLEXCGLNFFIN-QMMMGPOBSA-N |
| SMILES | CCC[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)