Products 1932192-99-8
CAS 1932192-99-8 is the registry number for Benzyl 2,3-O-isopropylidene-β-D-erythrofuranoside. Offered by: Chemat. Available pack sizes: 1g, 2g, 500mg, 5g.
(3aR,4R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (CAS 1932192-99-8) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (3aR,4R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole. InChIKey: CFPPNCUCWHMQHL-JHJVBQTASA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (3aR,4R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| InChIKey | CFPPNCUCWHMQHL-JHJVBQTASA-N |
| SMILES | CC1(O[C@@H]2CO[C@H]([C@@H]2O1)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)