Products 1933520-28-5
CAS 1933520-28-5 is the registry number for 4-Aminophenyl (2E)-3-(4-aminophenyl)-2-methyl-2-propenoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-aminophenyl) (E)-3-(4-aminophenyl)-2-methylprop-2-enoate (CAS 1933520-28-5) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: (4-aminophenyl) (E)-3-(4-aminophenyl)-2-methylprop-2-enoate. InChIKey: DJHOSSWOMAPLKS-ZHACJKMWSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (4-aminophenyl) (E)-3-(4-aminophenyl)-2-methylprop-2-enoate |
| InChIKey | DJHOSSWOMAPLKS-ZHACJKMWSA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)N)/C(=O)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)