CAS 1934564-58-5 appears in our catalog under these names: 1-tert-butoxycarbonyl-3-(cyanomethyl)azetidine-3-carboxylic acid, 95%, 95%, 1-(TERT-BUTOXYCARBONYL)-3-(CYANOMETHYL)AZETIDINE-3-CARBOXYLIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(cyanomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 1934564-58-5) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 3-(cyanomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: JQFRQWUJNNTDPF-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 3-(cyanomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | JQFRQWUJNNTDPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CC#N)C(=O)O |
Computed by PubChem (NCBI)